C7H14F2N2 — CID 2758354
2-(4,4-difluoropiperidin-1-yl)ethanamine (PubChem CID 2758354) has the molecular formula C7H14F2N2 and a molecular weight of 164.20 g/mol. Its IUPAC name is 2-(4,4-difluoropiperidin-1-yl)ethanamine.
| Compound Name | 2-(4,4-difluoropiperidin-1-yl)ethanamine |
|---|---|
| PubChem CID | 2758354 |
| Molecular Formula | C7H14F2N2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | 2-(4,4-difluoropiperidin-1-yl)ethanamine |
| SMILES | NCCN1CCC(F)(F)CC1 |
| InChI | InChI=1S/C7H14F2N2/c8-7(9)1-4-11(5-2-7)6-3-10/h1-6,10H2 |
| InChIKey | BVYNFUYPUXPMCI-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |