C13H27N5O — CID 117235825
1-[2-(4-methylpiperazin-1-yl)ethyl]-3-piperidin-3-ylurea (PubChem CID 117235825) has the molecular formula C13H27N5O and a molecular weight of 269.39 g/mol. Its IUPAC name is 1-[2-(4-methylpiperazin-1-yl)ethyl]-3-piperidin-3-ylurea.
| Compound Name | 1-[2-(4-methylpiperazin-1-yl)ethyl]-3-piperidin-3-ylurea |
|---|---|
| PubChem CID | 117235825 |
| Molecular Formula | C13H27N5O |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.22 |
| IUPAC Name | 1-[2-(4-methylpiperazin-1-yl)ethyl]-3-piperidin-3-ylurea |
| SMILES | CN1CCN(CCNC(=O)NC2CCCNC2)CC1 |
| InChI | InChI=1S/C13H27N5O/c1-17-7-9-18(10-8-17)6-5-15-13(19)16-12-3-2-4-14-11-12/h12,14H,2-11H2,1H3,(H2,15,16,19) |
| InChIKey | JSPKMFSSHWAKRW-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |