C14H29N5O — CID 117235828
1-[2-(4-methylpiperazin-1-yl)ethyl]-3-(piperidin-2-ylmethyl)urea (PubChem CID 117235828) has the molecular formula C14H29N5O and a molecular weight of 283.42 g/mol. Its IUPAC name is 1-[2-(4-methylpiperazin-1-yl)ethyl]-3-(piperidin-2-ylmethyl)urea.
| Compound Name | 1-[2-(4-methylpiperazin-1-yl)ethyl]-3-(piperidin-2-ylmethyl)urea |
|---|---|
| PubChem CID | 117235828 |
| Molecular Formula | C14H29N5O |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.24 |
| IUPAC Name | 1-[2-(4-methylpiperazin-1-yl)ethyl]-3-(piperidin-2-ylmethyl)urea |
| SMILES | CN1CCN(CCNC(=O)NCC2CCCCN2)CC1 |
| InChI | InChI=1S/C14H29N5O/c1-18-8-10-19(11-9-18)7-6-16-14(20)17-12-13-4-2-3-5-15-13/h13,15H,2-12H2,1H3,(H2,16,17,20) |
| InChIKey | VOCRKDNDHXHYIZ-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |