C22H36N4O — CID 126434100
1-[[1-(2-phenylethyl)piperidin-4-yl]methyl]-3-[2-[(2S)-piperidin-2-yl]ethyl]urea (PubChem CID 126434100) has the molecular formula C22H36N4O and a molecular weight of 372.56 g/mol. Its IUPAC name is 1-[[1-(2-phenylethyl)piperidin-4-yl]methyl]-3-[2-[(2S)-piperidin-2-yl]ethyl]urea.
| Compound Name | 1-[[1-(2-phenylethyl)piperidin-4-yl]methyl]-3-[2-[(2S)-piperidin-2-yl]ethyl]urea |
|---|---|
| PubChem CID | 126434100 |
| Molecular Formula | C22H36N4O |
| Molecular Weight | 372.56 g/mol |
| Exact Mass | 372.29 |
| IUPAC Name | 1-[[1-(2-phenylethyl)piperidin-4-yl]methyl]-3-[2-[(2S)-piperidin-2-yl]ethyl]urea |
| SMILES | O=C(NCC[C@@H]1CCCCN1)NCC1CCN(CCc2ccccc2)CC1 |
| InChI | InChI=1S/C22H36N4O/c27-22(24-14-9-21-8-4-5-13-23-21)25-18-20-11-16-26(17-12-20)15-10-19-6-2-1-3-7-19/h1-3,6-7,20-21,23H,4-5,8-18H2,(H2,24,25,27)/t21-/m0/s1 |
| InChIKey | BINVICOCIIYAIO-NRFANRHFSA-N |
| XLogP | 2.77 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.56 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |