C18H29Cl2N3O — CID 119838033
1-[4-(2-phenylethyl)piperazin-1-yl]-2-pyrrolidin-2-ylethanone;dihydrochloride (PubChem CID 119838033) has the molecular formula C18H29Cl2N3O and a molecular weight of 374.36 g/mol. Its IUPAC name is 1-[4-(2-phenylethyl)piperazin-1-yl]-2-pyrrolidin-2-ylethanone;dihydrochloride.
| Compound Name | 1-[4-(2-phenylethyl)piperazin-1-yl]-2-pyrrolidin-2-ylethanone;dihydrochloride |
|---|---|
| PubChem CID | 119838033 |
| Molecular Formula | C18H29Cl2N3O |
| Molecular Weight | 374.36 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 1-[4-(2-phenylethyl)piperazin-1-yl]-2-pyrrolidin-2-ylethanone;dihydrochloride |
| SMILES | Cl.Cl.O=C(CC1CCCN1)N1CCN(CCc2ccccc2)CC1 |
| InChI | InChI=1S/C18H27N3O.2ClH/c22-18(15-17-7-4-9-19-17)21-13-11-20(12-14-21)10-8-16-5-2-1-3-6-16;;/h1-3,5-6,17,19H,4,7-15H2;2*1H |
| InChIKey | AKJHZJWQQZVSIF-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.36 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |