C17H24ClN3O — CID 119832684
1-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-2-pyrrolidin-2-ylethanone (PubChem CID 119832684) has the molecular formula C17H24ClN3O and a molecular weight of 321.85 g/mol. Its IUPAC name is 1-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-2-pyrrolidin-2-ylethanone.
| Compound Name | 1-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-2-pyrrolidin-2-ylethanone |
|---|---|
| PubChem CID | 119832684 |
| Molecular Formula | C17H24ClN3O |
| Molecular Weight | 321.85 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 1-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-2-pyrrolidin-2-ylethanone |
| SMILES | O=C(CC1CCCN1)N1CCN(Cc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C17H24ClN3O/c18-15-4-1-3-14(11-15)13-20-7-9-21(10-8-20)17(22)12-16-5-2-6-19-16/h1,3-4,11,16,19H,2,5-10,12-13H2 |
| InChIKey | BJACSBWQKYQCIH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.85 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |