C13H16ClNO2 — CID 65127484
(3-chlorophenyl)methyl 2-pyrrolidin-2-ylacetate (PubChem CID 65127484) has the molecular formula C13H16ClNO2 and a molecular weight of 253.73 g/mol. Its IUPAC name is (3-chlorophenyl)methyl 2-pyrrolidin-2-ylacetate.
| Compound Name | (3-chlorophenyl)methyl 2-pyrrolidin-2-ylacetate |
|---|---|
| PubChem CID | 65127484 |
| Molecular Formula | C13H16ClNO2 |
| Molecular Weight | 253.73 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | (3-chlorophenyl)methyl 2-pyrrolidin-2-ylacetate |
| SMILES | O=C(CC1CCCN1)OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C13H16ClNO2/c14-11-4-1-3-10(7-11)9-17-13(16)8-12-5-2-6-15-12/h1,3-4,7,12,15H,2,5-6,8-9H2 |
| InChIKey | RSHKTQSUVRJAHQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.73 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |