C15H20ClNO2 — CID 114430091
(3-chlorophenyl)methyl 4-ethylpiperidine-2-carboxylate (PubChem CID 114430091) has the molecular formula C15H20ClNO2 and a molecular weight of 281.78 g/mol. Its IUPAC name is (3-chlorophenyl)methyl 4-ethylpiperidine-2-carboxylate.
| Compound Name | (3-chlorophenyl)methyl 4-ethylpiperidine-2-carboxylate |
|---|---|
| PubChem CID | 114430091 |
| Molecular Formula | C15H20ClNO2 |
| Molecular Weight | 281.78 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | (3-chlorophenyl)methyl 4-ethylpiperidine-2-carboxylate |
| SMILES | CCC1CCNC(C(=O)OCc2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C15H20ClNO2/c1-2-11-6-7-17-14(9-11)15(18)19-10-12-4-3-5-13(16)8-12/h3-5,8,11,14,17H,2,6-7,9-10H2,1H3 |
| InChIKey | OVMIWOFQRRWYMD-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.78 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |