About (3-chlorophenyl)methyl 4-aminocyclopent-2-ene-1-carboxylate
(3-chlorophenyl)methyl 4-aminocyclopent-2-ene-1-carboxylate (PubChem CID 79209447) has the molecular formula C13H14ClNO2
and a molecular weight of 251.71 g/mol. Its IUPAC name is (3-chlorophenyl)methyl 4-aminocyclopent-2-ene-1-carboxylate.
Molecular Properties
| Compound Name | (3-chlorophenyl)methyl 4-aminocyclopent-2-ene-1-carboxylate |
| PubChem CID | 79209447 |
| Molecular Formula | C13H14ClNO2 |
| Molecular Weight | 251.71 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | (3-chlorophenyl)methyl 4-aminocyclopent-2-ene-1-carboxylate |
| SMILES | NC1C=CC(C(=O)OCc2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C13H14ClNO2/c14-11-3-1-2-9(6-11)8-17-13(16)10-4-5-12(15)7-10/h1-6,10,12H,7-8,15H2 |
| InChIKey | MJMLJQJVSKIYDK-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.71 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3-chlorophenyl)methyl 4-aminocyclopent-2-ene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-chlorophenyl)methyl 4-aminocyclopent-2-ene-1-carboxylate?
The IUPAC name of (3-chlorophenyl)methyl 4-aminocyclopent-2-ene-1-carboxylate (CID 79209447) is (3-chlorophenyl)methyl 4-aminocyclopent-2-ene-1-carboxylate.
What is the SMILES notation for (3-chlorophenyl)methyl 4-aminocyclopent-2-ene-1-carboxylate?
The canonical SMILES for (3-chlorophenyl)methyl 4-aminocyclopent-2-ene-1-carboxylate is NC1C=CC(C(=O)OCc2cccc(Cl)c2)C1.
What is the InChIKey of (3-chlorophenyl)methyl 4-aminocyclopent-2-ene-1-carboxylate?
The InChIKey is MJMLJQJVSKIYDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14ClNO2/c14-11-3-1-2-9(6-11)8-17-13(16)10-4-5-12(15)7-10/h1-6,10,12H,7-8,15H2.
What are the key properties of (3-chlorophenyl)methyl 4-aminocyclopent-2-ene-1-carboxylate?
(3-chlorophenyl)methyl 4-aminocyclopent-2-ene-1-carboxylate has a molecular weight of 251.71 g/mol, XLogP of 2.29, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-chlorophenyl)methyl 4-aminocyclopent-2-ene-1-carboxylate is sourced from PubChem (CID 79209447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).