About (3-chlorophenyl)methyl 4-(methylamino)oxolane-3-carboxylate
(3-chlorophenyl)methyl 4-(methylamino)oxolane-3-carboxylate (PubChem CID 66267072) has the molecular formula C13H16ClNO3
and a molecular weight of 269.73 g/mol. Its IUPAC name is (3-chlorophenyl)methyl 4-(methylamino)oxolane-3-carboxylate.
Molecular Properties
| Compound Name | (3-chlorophenyl)methyl 4-(methylamino)oxolane-3-carboxylate |
| PubChem CID | 66267072 |
| Molecular Formula | C13H16ClNO3 |
| Molecular Weight | 269.73 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | (3-chlorophenyl)methyl 4-(methylamino)oxolane-3-carboxylate |
| SMILES | CNC1COCC1C(=O)OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C13H16ClNO3/c1-15-12-8-17-7-11(12)13(16)18-6-9-3-2-4-10(14)5-9/h2-5,11-12,15H,6-8H2,1H3 |
| InChIKey | OQPCISHORNCAFO-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.73 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-chlorophenyl)methyl 4-(methylamino)oxolane-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-chlorophenyl)methyl 4-(methylamino)oxolane-3-carboxylate?
The IUPAC name of (3-chlorophenyl)methyl 4-(methylamino)oxolane-3-carboxylate (CID 66267072) is (3-chlorophenyl)methyl 4-(methylamino)oxolane-3-carboxylate.
What is the SMILES notation for (3-chlorophenyl)methyl 4-(methylamino)oxolane-3-carboxylate?
The canonical SMILES for (3-chlorophenyl)methyl 4-(methylamino)oxolane-3-carboxylate is CNC1COCC1C(=O)OCc1cccc(Cl)c1.
What is the InChIKey of (3-chlorophenyl)methyl 4-(methylamino)oxolane-3-carboxylate?
The InChIKey is OQPCISHORNCAFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16ClNO3/c1-15-12-8-17-7-11(12)13(16)18-6-9-3-2-4-10(14)5-9/h2-5,11-12,15H,6-8H2,1H3.
What are the key properties of (3-chlorophenyl)methyl 4-(methylamino)oxolane-3-carboxylate?
(3-chlorophenyl)methyl 4-(methylamino)oxolane-3-carboxylate has a molecular weight of 269.73 g/mol, XLogP of 1.62, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-chlorophenyl)methyl 4-(methylamino)oxolane-3-carboxylate is sourced from PubChem (CID 66267072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).