C12H14ClNO3 — CID 65127027
(3-chlorophenyl)methyl (2S,4R)-4-hydroxypyrrolidine-2-carboxylate (PubChem CID 65127027) has the molecular formula C12H14ClNO3 and a molecular weight of 255.70 g/mol. Its IUPAC name is (3-chlorophenyl)methyl (2S,4R)-4-hydroxypyrrolidine-2-carboxylate.
| Compound Name | (3-chlorophenyl)methyl (2S,4R)-4-hydroxypyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 65127027 |
| Molecular Formula | C12H14ClNO3 |
| Molecular Weight | 255.70 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | (3-chlorophenyl)methyl (2S,4R)-4-hydroxypyrrolidine-2-carboxylate |
| SMILES | O=C(OCc1cccc(Cl)c1)[C@@H]1C[C@@H](O)CN1 |
| InChI | InChI=1S/C12H14ClNO3/c13-9-3-1-2-8(4-9)7-17-12(16)11-5-10(15)6-14-11/h1-4,10-11,14-15H,5-7H2/t10-,11+/m1/s1 |
| InChIKey | MFSWXBUYXZYGJG-MNOVXSKESA-N |
| XLogP | 1.11 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.70 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |