C11H14ClN — CID 7022802
(2S)-2-[(3-chlorophenyl)methyl]pyrrolidine (PubChem CID 7022802) has the molecular formula C11H14ClN and a molecular weight of 195.69 g/mol. Its IUPAC name is (2S)-2-[(3-chlorophenyl)methyl]pyrrolidine.
| Compound Name | (2S)-2-[(3-chlorophenyl)methyl]pyrrolidine |
|---|---|
| PubChem CID | 7022802 |
| Molecular Formula | C11H14ClN |
| Molecular Weight | 195.69 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | (2S)-2-[(3-chlorophenyl)methyl]pyrrolidine |
| SMILES | Clc1cccc(C[C@@H]2CCCN2)c1 |
| InChI | InChI=1S/C11H14ClN/c12-10-4-1-3-9(7-10)8-11-5-2-6-13-11/h1,3-4,7,11,13H,2,5-6,8H2/t11-/m0/s1 |
| InChIKey | QUAHLSVNDCUURH-NSHDSACASA-N |
| XLogP | 2.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.69 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |