C11H23N5O2 — CID 54861073
N-(2-aminoethyl)-N'-[2-(4-methylpiperazin-1-yl)ethyl]oxamide (PubChem CID 54861073) has the molecular formula C11H23N5O2 and a molecular weight of 257.34 g/mol. Its IUPAC name is N-(2-aminoethyl)-N'-[2-(4-methylpiperazin-1-yl)ethyl]oxamide.
| Compound Name | N-(2-aminoethyl)-N'-[2-(4-methylpiperazin-1-yl)ethyl]oxamide |
|---|---|
| PubChem CID | 54861073 |
| Molecular Formula | C11H23N5O2 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | N-(2-aminoethyl)-N'-[2-(4-methylpiperazin-1-yl)ethyl]oxamide |
| SMILES | CN1CCN(CCNC(=O)C(=O)NCCN)CC1 |
| InChI | InChI=1S/C11H23N5O2/c1-15-6-8-16(9-7-15)5-4-14-11(18)10(17)13-3-2-12/h2-9,12H2,1H3,(H,13,17)(H,14,18) |
| InChIKey | HYAOEMXETALDAK-UHFFFAOYSA-N |
| XLogP | -2.58 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | -2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|