C14H27N3O4 — CID 110397582
tert-butyl 4-[2-(ethoxycarbonylamino)ethyl]piperazine-1-carboxylate (PubChem CID 110397582) has the molecular formula C14H27N3O4 and a molecular weight of 301.39 g/mol. Its IUPAC name is tert-butyl 4-[2-(ethoxycarbonylamino)ethyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(ethoxycarbonylamino)ethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 110397582 |
| Molecular Formula | C14H27N3O4 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | tert-butyl 4-[2-(ethoxycarbonylamino)ethyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)NCCN1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C14H27N3O4/c1-5-20-12(18)15-6-7-16-8-10-17(11-9-16)13(19)21-14(2,3)4/h5-11H2,1-4H3,(H,15,18) |
| InChIKey | NLDGXOLUUBXXIT-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |