C15H22N2O3S — CID 160504996
2-aminooxy-N-[2-(3-sulfanylpropoxy)ethyl]acetamide;octa-2,4,6-triyne (PubChem CID 160504996) has the molecular formula C15H22N2O3S and a molecular weight of 310.42 g/mol. Its IUPAC name is 2-aminooxy-N-[2-(3-sulfanylpropoxy)ethyl]acetamide;octa-2,4,6-triyne.
| Compound Name | 2-aminooxy-N-[2-(3-sulfanylpropoxy)ethyl]acetamide;octa-2,4,6-triyne |
|---|---|
| PubChem CID | 160504996 |
| Molecular Formula | C15H22N2O3S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 2-aminooxy-N-[2-(3-sulfanylpropoxy)ethyl]acetamide;octa-2,4,6-triyne |
| SMILES | CC#CC#CC#CC.NOCC(=O)NCCOCCCS |
| InChI | InChI=1S/C8H6.C7H16N2O3S/c1-3-5-7-8-6-4-2;8-12-6-7(10)9-2-4-11-3-1-5-13/h1-2H3;13H,1-6,8H2,(H,9,10) |
| InChIKey | QSGZEUOKPJXXNM-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|