C7H13NO3 — CID 158723077
N-[2-(3-oxopropoxy)ethyl]acetamide (PubChem CID 158723077) has the molecular formula C7H13NO3 and a molecular weight of 159.19 g/mol. Its IUPAC name is N-[2-(3-oxopropoxy)ethyl]acetamide.
| Compound Name | N-[2-(3-oxopropoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 158723077 |
| Molecular Formula | C7H13NO3 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | N-[2-(3-oxopropoxy)ethyl]acetamide |
| SMILES | CC(=O)NCCOCCC=O |
| InChI | InChI=1S/C7H13NO3/c1-7(10)8-3-6-11-5-2-4-9/h4H,2-3,5-6H2,1H3,(H,8,10) |
| InChIKey | APGOPPLHRDXWQM-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|