C15H27NO10 — CID 171541687
2,3-dihydroxy-4-oxo-4-[2-[2-[2-[2-(3-oxopropoxy)ethoxy]ethoxy]ethoxy]ethylamino]butanoic acid (PubChem CID 171541687) has the molecular formula C15H27NO10 and a molecular weight of 381.38 g/mol. Its IUPAC name is 2,3-dihydroxy-4-oxo-4-[2-[2-[2-[2-(3-oxopropoxy)ethoxy]ethoxy]ethoxy]ethylamino]butanoic acid.
| Compound Name | 2,3-dihydroxy-4-oxo-4-[2-[2-[2-[2-(3-oxopropoxy)ethoxy]ethoxy]ethoxy]ethylamino]butanoic acid |
|---|---|
| PubChem CID | 171541687 |
| Molecular Formula | C15H27NO10 |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 2,3-dihydroxy-4-oxo-4-[2-[2-[2-[2-(3-oxopropoxy)ethoxy]ethoxy]ethoxy]ethylamino]butanoic acid |
| SMILES | O=CCCOCCOCCOCCOCCNC(=O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C15H27NO10/c17-3-1-4-23-6-8-25-10-11-26-9-7-24-5-2-16-14(20)12(18)13(19)15(21)22/h3,12-13,18-19H,1-2,4-11H2,(H,16,20)(H,21,22) |
| InChIKey | SWKASIRQANMJDD-UHFFFAOYSA-N |
| XLogP | -2.44 |
| TPSA | 160.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | -2.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|