C13H26N2O7 — CID 163855261
(2R,3R)-N-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]-2,3-dihydroxy-4-oxopentanamide (PubChem CID 163855261) has the molecular formula C13H26N2O7 and a molecular weight of 322.36 g/mol. Its IUPAC name is (2R,3R)-N-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]-2,3-dihydroxy-4-oxopentanamide.
| Compound Name | (2R,3R)-N-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]-2,3-dihydroxy-4-oxopentanamide |
|---|---|
| PubChem CID | 163855261 |
| Molecular Formula | C13H26N2O7 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | (2R,3R)-N-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]-2,3-dihydroxy-4-oxopentanamide |
| SMILES | CC(=O)[C@H](O)[C@@H](O)C(=O)NCCOCCOCCOCCN |
| InChI | InChI=1S/C13H26N2O7/c1-10(16)11(17)12(18)13(19)15-3-5-21-7-9-22-8-6-20-4-2-14/h11-12,17-18H,2-9,14H2,1H3,(H,15,19)/t11-,12+/m0/s1 |
| InChIKey | OXTAYYYVTWTWQG-NWDGAFQWSA-N |
| XLogP | -2.58 |
| TPSA | 140.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | -2.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|