C6H14N2O2S — CID 139475977
S-methyl N-[2-(2-aminoethoxy)ethyl]carbamothioate (PubChem CID 139475977) has the molecular formula C6H14N2O2S and a molecular weight of 178.26 g/mol. Its IUPAC name is S-methyl N-[2-(2-aminoethoxy)ethyl]carbamothioate.
| Compound Name | S-methyl N-[2-(2-aminoethoxy)ethyl]carbamothioate |
|---|---|
| PubChem CID | 139475977 |
| Molecular Formula | C6H14N2O2S |
| Molecular Weight | 178.26 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | S-methyl N-[2-(2-aminoethoxy)ethyl]carbamothioate |
| SMILES | CSC(=O)NCCOCCN |
| InChI | InChI=1S/C6H14N2O2S/c1-11-6(9)8-3-5-10-4-2-7/h2-5,7H2,1H3,(H,8,9) |
| InChIKey | PTXFLXZKLZNOHQ-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.26 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|