C13H26N2O4 — CID 142404359
N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4,4-dimethyl-3-oxopentanamide (PubChem CID 142404359) has the molecular formula C13H26N2O4 and a molecular weight of 274.36 g/mol. Its IUPAC name is N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4,4-dimethyl-3-oxopentanamide.
| Compound Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4,4-dimethyl-3-oxopentanamide |
|---|---|
| PubChem CID | 142404359 |
| Molecular Formula | C13H26N2O4 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4,4-dimethyl-3-oxopentanamide |
| SMILES | CC(C)(C)C(=O)CC(=O)NCCOCCOCCN |
| InChI | InChI=1S/C13H26N2O4/c1-13(2,3)11(16)10-12(17)15-5-7-19-9-8-18-6-4-14/h4-10,14H2,1-3H3,(H,15,17) |
| InChIKey | MHZRYRLOFKXUMW-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|