C18H36N2O5 — CID 143771941
N-[3-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]propyl]-5,5-dimethyl-4-oxohexanamide (PubChem CID 143771941) has the molecular formula C18H36N2O5 and a molecular weight of 360.50 g/mol. Its IUPAC name is N-[3-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]propyl]-5,5-dimethyl-4-oxohexanamide.
| Compound Name | N-[3-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]propyl]-5,5-dimethyl-4-oxohexanamide |
|---|---|
| PubChem CID | 143771941 |
| Molecular Formula | C18H36N2O5 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.26 |
| IUPAC Name | N-[3-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]propyl]-5,5-dimethyl-4-oxohexanamide |
| SMILES | CC(C)(C)C(=O)CCC(=O)NCCCOCCOCCOCCCN |
| InChI | InChI=1S/C18H36N2O5/c1-18(2,3)16(21)6-7-17(22)20-9-5-11-24-13-15-25-14-12-23-10-4-8-19/h4-15,19H2,1-3H3,(H,20,22) |
| InChIKey | GHWGUVKQFNLUAP-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|