C12H27N3O4 — CID 123586963
2-amino-N-[3-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]propyl]acetamide (PubChem CID 123586963) has the molecular formula C12H27N3O4 and a molecular weight of 277.36 g/mol. Its IUPAC name is 2-amino-N-[3-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]propyl]acetamide.
| Compound Name | 2-amino-N-[3-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]propyl]acetamide |
|---|---|
| PubChem CID | 123586963 |
| Molecular Formula | C12H27N3O4 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | 2-amino-N-[3-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]propyl]acetamide |
| SMILES | NCCCOCCOCCOCCCNC(=O)CN |
| InChI | InChI=1S/C12H27N3O4/c13-3-1-5-17-7-9-19-10-8-18-6-2-4-15-12(16)11-14/h1-11,13-14H2,(H,15,16) |
| InChIKey | MJIUWBANJNMPMX-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|