C14H26Br2N2O5 — CID 164805844
2-bromo-N-[3-[2-[2-[3-[(2-bromoacetyl)amino]propoxy]ethoxy]ethoxy]propyl]acetamide (PubChem CID 164805844) has the molecular formula C14H26Br2N2O5 and a molecular weight of 462.18 g/mol. Its IUPAC name is 2-bromo-N-[3-[2-[2-[3-[(2-bromoacetyl)amino]propoxy]ethoxy]ethoxy]propyl]acetamide.
| Compound Name | 2-bromo-N-[3-[2-[2-[3-[(2-bromoacetyl)amino]propoxy]ethoxy]ethoxy]propyl]acetamide |
|---|---|
| PubChem CID | 164805844 |
| Molecular Formula | C14H26Br2N2O5 |
| Molecular Weight | 462.18 g/mol |
| Exact Mass | 460.02 |
| IUPAC Name | 2-bromo-N-[3-[2-[2-[3-[(2-bromoacetyl)amino]propoxy]ethoxy]ethoxy]propyl]acetamide |
| SMILES | O=C(CBr)NCCCOCCOCCOCCCNC(=O)CBr |
| InChI | InChI=1S/C14H26Br2N2O5/c15-11-13(19)17-3-1-5-21-7-9-23-10-8-22-6-2-4-18-14(20)12-16/h1-12H2,(H,17,19)(H,18,20) |
| InChIKey | JMWKSGTZDZUAAG-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.18 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|