C18H40N2O4 — CID 166555356
ethane;N-[3-[2-[2-[3-(propan-2-ylamino)propoxy]ethoxy]ethoxy]propyl]propanamide (PubChem CID 166555356) has the molecular formula C18H40N2O4 and a molecular weight of 348.53 g/mol. Its IUPAC name is ethane;N-[3-[2-[2-[3-(propan-2-ylamino)propoxy]ethoxy]ethoxy]propyl]propanamide.
| Compound Name | ethane;N-[3-[2-[2-[3-(propan-2-ylamino)propoxy]ethoxy]ethoxy]propyl]propanamide |
|---|---|
| PubChem CID | 166555356 |
| Molecular Formula | C18H40N2O4 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.30 |
| IUPAC Name | ethane;N-[3-[2-[2-[3-(propan-2-ylamino)propoxy]ethoxy]ethoxy]propyl]propanamide |
| SMILES | CC.CCC(=O)NCCCOCCOCCOCCCNC(C)C |
| InChI | InChI=1S/C16H34N2O4.C2H6/c1-4-16(19)18-8-6-10-21-12-14-22-13-11-20-9-5-7-17-15(2)3;1-2/h15,17H,4-14H2,1-3H3,(H,18,19);1-2H3 |
| InChIKey | IKBNJPAXOJVDOZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|