C8H15BrN2O3 — CID 82108968
2-[(2-bromoacetyl)amino]-N-(3-methoxypropyl)acetamide (PubChem CID 82108968) has the molecular formula C8H15BrN2O3 and a molecular weight of 267.12 g/mol. Its IUPAC name is 2-[(2-bromoacetyl)amino]-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-[(2-bromoacetyl)amino]-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 82108968 |
| Molecular Formula | C8H15BrN2O3 |
| Molecular Weight | 267.12 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | 2-[(2-bromoacetyl)amino]-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)CNC(=O)CBr |
| InChI | InChI=1S/C8H15BrN2O3/c1-14-4-2-3-10-8(13)6-11-7(12)5-9/h2-6H2,1H3,(H,10,13)(H,11,12) |
| InChIKey | MBTRNHUIYZHOSC-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.12 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|