C11H24N2O4 — CID 106309953
2-[3-(2-hydroxyethoxy)propylamino]-N-(3-methoxypropyl)acetamide (PubChem CID 106309953) has the molecular formula C11H24N2O4 and a molecular weight of 248.32 g/mol. Its IUPAC name is 2-[3-(2-hydroxyethoxy)propylamino]-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-[3-(2-hydroxyethoxy)propylamino]-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 106309953 |
| Molecular Formula | C11H24N2O4 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | 2-[3-(2-hydroxyethoxy)propylamino]-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)CNCCCOCCO |
| InChI | InChI=1S/C11H24N2O4/c1-16-7-3-5-13-11(15)10-12-4-2-8-17-9-6-14/h12,14H,2-10H2,1H3,(H,13,15) |
| InChIKey | MKXXTSZJLJLHCA-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|