C10H23N3O4S — CID 106336845
2-[3-(methanesulfonamido)propylamino]-N-(3-methoxypropyl)acetamide (PubChem CID 106336845) has the molecular formula C10H23N3O4S and a molecular weight of 281.38 g/mol. Its IUPAC name is 2-[3-(methanesulfonamido)propylamino]-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-[3-(methanesulfonamido)propylamino]-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 106336845 |
| Molecular Formula | C10H23N3O4S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 2-[3-(methanesulfonamido)propylamino]-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)CNCCCNS(C)(=O)=O |
| InChI | InChI=1S/C10H23N3O4S/c1-17-8-4-6-12-10(14)9-11-5-3-7-13-18(2,15)16/h11,13H,3-9H2,1-2H3,(H,12,14) |
| InChIKey | AIEMUVZKQNUYIC-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|