C10H20N2O5 — CID 108506395
N'-[2-(2-hydroxyethoxy)ethyl]-N-(3-methoxypropyl)oxamide (PubChem CID 108506395) has the molecular formula C10H20N2O5 and a molecular weight of 248.28 g/mol. Its IUPAC name is N'-[2-(2-hydroxyethoxy)ethyl]-N-(3-methoxypropyl)oxamide.
| Compound Name | N'-[2-(2-hydroxyethoxy)ethyl]-N-(3-methoxypropyl)oxamide |
|---|---|
| PubChem CID | 108506395 |
| Molecular Formula | C10H20N2O5 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | N'-[2-(2-hydroxyethoxy)ethyl]-N-(3-methoxypropyl)oxamide |
| SMILES | COCCCNC(=O)C(=O)NCCOCCO |
| InChI | InChI=1S/C10H20N2O5/c1-16-6-2-3-11-9(14)10(15)12-4-7-17-8-5-13/h13H,2-8H2,1H3,(H,11,14)(H,12,15) |
| InChIKey | QAGWTVDQQPWLLL-UHFFFAOYSA-N |
| XLogP | -1.74 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|