C16H34N4O5 — CID 89399442
2-(methylamino)-N-[3-[2-[2-[3-[[2-(methylamino)acetyl]amino]propoxy]ethoxy]ethoxy]propyl]acetamide (PubChem CID 89399442) has the molecular formula C16H34N4O5 and a molecular weight of 362.47 g/mol. Its IUPAC name is 2-(methylamino)-N-[3-[2-[2-[3-[[2-(methylamino)acetyl]amino]propoxy]ethoxy]ethoxy]propyl]acetamide.
| Compound Name | 2-(methylamino)-N-[3-[2-[2-[3-[[2-(methylamino)acetyl]amino]propoxy]ethoxy]ethoxy]propyl]acetamide |
|---|---|
| PubChem CID | 89399442 |
| Molecular Formula | C16H34N4O5 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | 2-(methylamino)-N-[3-[2-[2-[3-[[2-(methylamino)acetyl]amino]propoxy]ethoxy]ethoxy]propyl]acetamide |
| SMILES | CNCC(=O)NCCCOCCOCCOCCCNC(=O)CNC |
| InChI | InChI=1S/C16H34N4O5/c1-17-13-15(21)19-5-3-7-23-9-11-25-12-10-24-8-4-6-20-16(22)14-18-2/h17-18H,3-14H2,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | IGGHFIJJEZHSMR-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 109.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|