C7H13NO2 — CID 36691364
2-(cyclopentylazaniumyl)acetate (PubChem CID 36691364) has the molecular formula C7H13NO2 and a molecular weight of 143.19 g/mol. Its IUPAC name is 2-(cyclopentylazaniumyl)acetate.
| Compound Name | 2-(cyclopentylazaniumyl)acetate |
|---|---|
| PubChem CID | 36691364 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | 2-(cyclopentylazaniumyl)acetate |
| SMILES | O=C([O-])C[NH2+]C1CCCC1 |
| InChI | InChI=1S/C7H13NO2/c9-7(10)5-8-6-3-1-2-4-6/h6,8H,1-5H2,(H,9,10) |
| InChIKey | LRHRHAWNXCGABU-UHFFFAOYSA-N |
| XLogP | -1.76 |
| TPSA | 56.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |