About butanoate;dicyclohexylazanium
butanoate;dicyclohexylazanium (PubChem CID 141420564) has the molecular formula C16H31NO2
and a molecular weight of 269.43 g/mol. Its IUPAC name is butanoate;dicyclohexylazanium.
Molecular Properties
| Compound Name | butanoate;dicyclohexylazanium |
| PubChem CID | 141420564 |
| Molecular Formula | C16H31NO2 |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.24 |
| IUPAC Name | butanoate;dicyclohexylazanium |
| SMILES | C1CCC([NH2+]C2CCCCC2)CC1.CCCC(=O)[O-] |
| InChI | InChI=1S/C12H23N.C4H8O2/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-2-3-4(5)6/h11-13H,1-10H2;2-3H2,1H3,(H,5,6) |
| InChIKey | UNXLIRBVXJCWHD-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 56.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze butanoate;dicyclohexylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanoate;dicyclohexylazanium?
The IUPAC name of butanoate;dicyclohexylazanium (CID 141420564) is butanoate;dicyclohexylazanium.
What is the SMILES notation for butanoate;dicyclohexylazanium?
The canonical SMILES for butanoate;dicyclohexylazanium is C1CCC([NH2+]C2CCCCC2)CC1.CCCC(=O)[O-].
What is the InChIKey of butanoate;dicyclohexylazanium?
The InChIKey is UNXLIRBVXJCWHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N.C4H8O2/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-2-3-4(5)6/h11-13H,1-10H2;2-3H2,1H3,(H,5,6).
What are the key properties of butanoate;dicyclohexylazanium?
butanoate;dicyclohexylazanium has a molecular weight of 269.43 g/mol, XLogP of 1.75, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butanoate;dicyclohexylazanium is sourced from PubChem (CID 141420564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).