About butanoate;1-methylpiperidin-1-ium
butanoate;1-methylpiperidin-1-ium (PubChem CID 67303574) has the molecular formula C10H21NO2
and a molecular weight of 187.28 g/mol. Its IUPAC name is butanoate;1-methylpiperidin-1-ium.
Molecular Properties
| Compound Name | butanoate;1-methylpiperidin-1-ium |
| PubChem CID | 67303574 |
| Molecular Formula | C10H21NO2 |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.16 |
| IUPAC Name | butanoate;1-methylpiperidin-1-ium |
| SMILES | CCCC(=O)[O-].C[NH+]1CCCCC1 |
| InChI | InChI=1S/C6H13N.C4H8O2/c1-7-5-3-2-4-6-7;1-2-3-4(5)6/h2-6H2,1H3;2-3H2,1H3,(H,5,6) |
| InChIKey | YQOHGAOCKGNLTI-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 44.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze butanoate;1-methylpiperidin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanoate;1-methylpiperidin-1-ium?
The IUPAC name of butanoate;1-methylpiperidin-1-ium (CID 67303574) is butanoate;1-methylpiperidin-1-ium.
What is the SMILES notation for butanoate;1-methylpiperidin-1-ium?
The canonical SMILES for butanoate;1-methylpiperidin-1-ium is CCCC(=O)[O-].C[NH+]1CCCCC1.
What is the InChIKey of butanoate;1-methylpiperidin-1-ium?
The InChIKey is YQOHGAOCKGNLTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N.C4H8O2/c1-7-5-3-2-4-6-7;1-2-3-4(5)6/h2-6H2,1H3;2-3H2,1H3,(H,5,6).
What are the key properties of butanoate;1-methylpiperidin-1-ium?
butanoate;1-methylpiperidin-1-ium has a molecular weight of 187.28 g/mol, XLogP of -0.78, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butanoate;1-methylpiperidin-1-ium is sourced from PubChem (CID 67303574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).