C8H14N6O2S — CID 83082361
[2-(cyclopropylcarbamoylamino)-2-oxoethyl] N-(diaminomethylidene)carbamimidothioate (PubChem CID 83082361) has the molecular formula C8H14N6O2S and a molecular weight of 258.31 g/mol. Its IUPAC name is [2-(cyclopropylcarbamoylamino)-2-oxoethyl] N-(diaminomethylidene)carbamimidothioate.
| Compound Name | [2-(cyclopropylcarbamoylamino)-2-oxoethyl] N-(diaminomethylidene)carbamimidothioate |
|---|---|
| PubChem CID | 83082361 |
| Molecular Formula | C8H14N6O2S |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | [2-(cyclopropylcarbamoylamino)-2-oxoethyl] N-(diaminomethylidene)carbamimidothioate |
| SMILES | [H]/N=C(\N=C(N)N)SCC(=O)NC(=O)NC1CC1 |
| InChI | InChI=1S/C8H14N6O2S/c9-6(10)14-7(11)17-3-5(15)13-8(16)12-4-1-2-4/h4H,1-3H2,(H5,9,10,11,14)(H2,12,13,15,16) |
| InChIKey | SZMBLTKNXFEHEI-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 146.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|