C11H24N2O4S — CID 122574248
(2S)-2-amino-4-ethylsulfanylbutanoic acid;(2S)-2-aminopentanoic acid (PubChem CID 122574248) has the molecular formula C11H24N2O4S and a molecular weight of 280.39 g/mol. Its IUPAC name is (2S)-2-amino-4-ethylsulfanylbutanoic acid;(2S)-2-aminopentanoic acid.
| Compound Name | (2S)-2-amino-4-ethylsulfanylbutanoic acid;(2S)-2-aminopentanoic acid |
|---|---|
| PubChem CID | 122574248 |
| Molecular Formula | C11H24N2O4S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | (2S)-2-amino-4-ethylsulfanylbutanoic acid;(2S)-2-aminopentanoic acid |
| SMILES | CCC[C@H](N)C(=O)O.CCSCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C6H13NO2S.C5H11NO2/c1-2-10-4-3-5(7)6(8)9;1-2-3-4(6)5(7)8/h5H,2-4,7H2,1H3,(H,8,9);4H,2-3,6H2,1H3,(H,7,8)/t5-;4-/m00/s1 |
| InChIKey | FXEXSNRWAKGIHO-VDQHJUMDSA-N |
| XLogP | 0.74 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|