C11H20N2O2S — CID 67804062
(2S)-2-amino-4-ethylsulfanylbutanoic acid;1,2-dihydropyridine (PubChem CID 67804062) has the molecular formula C11H20N2O2S and a molecular weight of 244.36 g/mol. Its IUPAC name is (2S)-2-amino-4-ethylsulfanylbutanoic acid;1,2-dihydropyridine.
| Compound Name | (2S)-2-amino-4-ethylsulfanylbutanoic acid;1,2-dihydropyridine |
|---|---|
| PubChem CID | 67804062 |
| Molecular Formula | C11H20N2O2S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | (2S)-2-amino-4-ethylsulfanylbutanoic acid;1,2-dihydropyridine |
| SMILES | C1=CCNC=C1.CCSCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C6H13NO2S.C5H7N/c1-2-10-4-3-5(7)6(8)9;1-2-4-6-5-3-1/h5H,2-4,7H2,1H3,(H,8,9);1-4,6H,5H2/t5-;/m0./s1 |
| InChIKey | ISPKQNLRZSCSGS-JEDNCBNOSA-N |
| XLogP | 1.20 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|