(2R)-2-amino-3-(2,2-dimethoxyethylsulfanyl)propanoic acid

C7H15NO4S — CID 54312308

IUPAC(2R)-2-amino-3-(2,2-dimethoxyethylsulfanyl)propanoic acid
SMILESCOC(CSC[C@H](N)C(=O)O)OC
InChIInChI=1S/C7H15NO4S/c1-11-6(12-2)4-13-3-5(8)7(9)10/h5-6H,3-4,8H2,1-2H3,(H,9,10)/t5-/m0/s1
InChIKeySLSXKCRIVICIOF-YFKPBYRVSA-N
MW209.27 g/mol
LogP-0.25
Rot. Bonds7

About (2R)-2-amino-3-(2,2-dimethoxyethylsulfanyl)propanoic acid

(2R)-2-amino-3-(2,2-dimethoxyethylsulfanyl)propanoic acid (PubChem CID 54312308) has the molecular formula C7H15NO4S and a molecular weight of 209.27 g/mol. Its IUPAC name is (2R)-2-amino-3-(2,2-dimethoxyethylsulfanyl)propanoic acid.

Molecular Properties

Compound Name(2R)-2-amino-3-(2,2-dimethoxyethylsulfanyl)propanoic acid
PubChem CID54312308
Molecular FormulaC7H15NO4S
Molecular Weight209.27 g/mol
Exact Mass209.07
IUPAC Name(2R)-2-amino-3-(2,2-dimethoxyethylsulfanyl)propanoic acid
SMILESCOC(CSC[C@H](N)C(=O)O)OC
InChIInChI=1S/C7H15NO4S/c1-11-6(12-2)4-13-3-5(8)7(9)10/h5-6H,3-4,8H2,1-2H3,(H,9,10)/t5-/m0/s1
InChIKeySLSXKCRIVICIOF-YFKPBYRVSA-N
XLogP-0.25
TPSA81.78 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500209.27
LogP ≤ 5-0.25
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze (2R)-2-amino-3-(2,2-dimethoxyethylsulfanyl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-2-amino-3-(2,2-dimethoxyethylsulfanyl)propanoic acid?
The IUPAC name of (2R)-2-amino-3-(2,2-dimethoxyethylsulfanyl)propanoic acid (CID 54312308) is (2R)-2-amino-3-(2,2-dimethoxyethylsulfanyl)propanoic acid.
What is the SMILES notation for (2R)-2-amino-3-(2,2-dimethoxyethylsulfanyl)propanoic acid?
The canonical SMILES for (2R)-2-amino-3-(2,2-dimethoxyethylsulfanyl)propanoic acid is COC(CSC[C@H](N)C(=O)O)OC.
What is the InChIKey of (2R)-2-amino-3-(2,2-dimethoxyethylsulfanyl)propanoic acid?
The InChIKey is SLSXKCRIVICIOF-YFKPBYRVSA-N. The full InChI is InChI=1S/C7H15NO4S/c1-11-6(12-2)4-13-3-5(8)7(9)10/h5-6H,3-4,8H2,1-2H3,(H,9,10)/t5-/m0/s1.
What are the key properties of (2R)-2-amino-3-(2,2-dimethoxyethylsulfanyl)propanoic acid?
(2R)-2-amino-3-(2,2-dimethoxyethylsulfanyl)propanoic acid has a molecular weight of 209.27 g/mol, XLogP of -0.25, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-3-(2,2-dimethoxyethylsulfanyl)propanoic acid is sourced from PubChem (CID 54312308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).