C7H15NO4S — CID 54312308
(2R)-2-amino-3-(2,2-dimethoxyethylsulfanyl)propanoic acid (PubChem CID 54312308) has the molecular formula C7H15NO4S and a molecular weight of 209.27 g/mol. Its IUPAC name is (2R)-2-amino-3-(2,2-dimethoxyethylsulfanyl)propanoic acid.
| Compound Name | (2R)-2-amino-3-(2,2-dimethoxyethylsulfanyl)propanoic acid |
|---|---|
| PubChem CID | 54312308 |
| Molecular Formula | C7H15NO4S |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | (2R)-2-amino-3-(2,2-dimethoxyethylsulfanyl)propanoic acid |
| SMILES | COC(CSC[C@H](N)C(=O)O)OC |
| InChI | InChI=1S/C7H15NO4S/c1-11-6(12-2)4-13-3-5(8)7(9)10/h5-6H,3-4,8H2,1-2H3,(H,9,10)/t5-/m0/s1 |
| InChIKey | SLSXKCRIVICIOF-YFKPBYRVSA-N |
| XLogP | -0.25 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|