C10H19N3O5S2 — CID 129098455
2-amino-3-[3-(2-amino-2-carboxyethyl)sulfanyl-2-methoxyiminopropyl]sulfanylpropanoic acid (PubChem CID 129098455) has the molecular formula C10H19N3O5S2 and a molecular weight of 325.41 g/mol. Its IUPAC name is 2-amino-3-[3-(2-amino-2-carboxyethyl)sulfanyl-2-methoxyiminopropyl]sulfanylpropanoic acid.
| Compound Name | 2-amino-3-[3-(2-amino-2-carboxyethyl)sulfanyl-2-methoxyiminopropyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 129098455 |
| Molecular Formula | C10H19N3O5S2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | 2-amino-3-[3-(2-amino-2-carboxyethyl)sulfanyl-2-methoxyiminopropyl]sulfanylpropanoic acid |
| SMILES | CON=C(CSCC(N)C(=O)O)CSCC(N)C(=O)O |
| InChI | InChI=1S/C10H19N3O5S2/c1-18-13-6(2-19-4-7(11)9(14)15)3-20-5-8(12)10(16)17/h7-8H,2-5,11-12H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | XDXRNSXRYZJLRA-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 148.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|