C6H10ClNO2S — CID 24696064
2-amino-3-(2-chloroprop-2-enylsulfanyl)propanoic acid (PubChem CID 24696064) has the molecular formula C6H10ClNO2S and a molecular weight of 195.67 g/mol. Its IUPAC name is 2-amino-3-(2-chloroprop-2-enylsulfanyl)propanoic acid.
| Compound Name | 2-amino-3-(2-chloroprop-2-enylsulfanyl)propanoic acid |
|---|---|
| PubChem CID | 24696064 |
| Molecular Formula | C6H10ClNO2S |
| Molecular Weight | 195.67 g/mol |
| Exact Mass | 195.01 |
| IUPAC Name | 2-amino-3-(2-chloroprop-2-enylsulfanyl)propanoic acid |
| SMILES | C=C(Cl)CSCC(N)C(=O)O |
| InChI | InChI=1S/C6H10ClNO2S/c1-4(7)2-11-3-5(8)6(9)10/h5H,1-3,8H2,(H,9,10) |
| InChIKey | HCPYEQUTBBDWDU-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.67 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |