C7H14N2O3S — CID 21345005
2-amino-3-(2-amino-3-oxobutyl)sulfanylpropanoic acid (PubChem CID 21345005) has the molecular formula C7H14N2O3S and a molecular weight of 206.27 g/mol. Its IUPAC name is 2-amino-3-(2-amino-3-oxobutyl)sulfanylpropanoic acid.
| Compound Name | 2-amino-3-(2-amino-3-oxobutyl)sulfanylpropanoic acid |
|---|---|
| PubChem CID | 21345005 |
| Molecular Formula | C7H14N2O3S |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 2-amino-3-(2-amino-3-oxobutyl)sulfanylpropanoic acid |
| SMILES | CC(=O)C(N)CSCC(N)C(=O)O |
| InChI | InChI=1S/C7H14N2O3S/c1-4(10)5(8)2-13-3-6(9)7(11)12/h5-6H,2-3,8-9H2,1H3,(H,11,12) |
| InChIKey | RQBNQYLZKRTDJO-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |