C6H13ClN2O3S — CID 21421850
3-(acetamidomethylsulfanyl)-2-aminopropanoic acid;hydrochloride (PubChem CID 21421850) has the molecular formula C6H13ClN2O3S and a molecular weight of 228.70 g/mol. Its IUPAC name is 3-(acetamidomethylsulfanyl)-2-aminopropanoic acid;hydrochloride.
| Compound Name | 3-(acetamidomethylsulfanyl)-2-aminopropanoic acid;hydrochloride |
|---|---|
| PubChem CID | 21421850 |
| Molecular Formula | C6H13ClN2O3S |
| Molecular Weight | 228.70 g/mol |
| Exact Mass | 228.03 |
| IUPAC Name | 3-(acetamidomethylsulfanyl)-2-aminopropanoic acid;hydrochloride |
| SMILES | CC(=O)NCSCC(N)C(=O)O.Cl |
| InChI | InChI=1S/C6H12N2O3S.ClH/c1-4(9)8-3-12-2-5(7)6(10)11;/h5H,2-3,7H2,1H3,(H,8,9)(H,10,11);1H |
| InChIKey | SZWPOAKLKGUXDD-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.70 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|