C7H15ClN2O3S — CID 21421845
2-amino-3-[(propanoylamino)methylsulfanyl]propanoic acid;hydrochloride (PubChem CID 21421845) has the molecular formula C7H15ClN2O3S and a molecular weight of 242.73 g/mol. Its IUPAC name is 2-amino-3-[(propanoylamino)methylsulfanyl]propanoic acid;hydrochloride.
| Compound Name | 2-amino-3-[(propanoylamino)methylsulfanyl]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 21421845 |
| Molecular Formula | C7H15ClN2O3S |
| Molecular Weight | 242.73 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 2-amino-3-[(propanoylamino)methylsulfanyl]propanoic acid;hydrochloride |
| SMILES | CCC(=O)NCSCC(N)C(=O)O.Cl |
| InChI | InChI=1S/C7H14N2O3S.ClH/c1-2-6(10)9-4-13-3-5(8)7(11)12;/h5H,2-4,8H2,1H3,(H,9,10)(H,11,12);1H |
| InChIKey | MFHOAQZCPUHVDD-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.73 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|