C9H14N2O4S — CID 154389821
(2R)-3-(acetamidomethylsulfanyl)-2-(prop-2-enoylamino)propanoic acid (PubChem CID 154389821) has the molecular formula C9H14N2O4S and a molecular weight of 246.29 g/mol. Its IUPAC name is (2R)-3-(acetamidomethylsulfanyl)-2-(prop-2-enoylamino)propanoic acid.
| Compound Name | (2R)-3-(acetamidomethylsulfanyl)-2-(prop-2-enoylamino)propanoic acid |
|---|---|
| PubChem CID | 154389821 |
| Molecular Formula | C9H14N2O4S |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | (2R)-3-(acetamidomethylsulfanyl)-2-(prop-2-enoylamino)propanoic acid |
| SMILES | C=CC(=O)N[C@@H](CSCNC(C)=O)C(=O)O |
| InChI | InChI=1S/C9H14N2O4S/c1-3-8(13)11-7(9(14)15)4-16-5-10-6(2)12/h3,7H,1,4-5H2,2H3,(H,10,12)(H,11,13)(H,14,15)/t7-/m0/s1 |
| InChIKey | XYXIBKMDAFAGJO-ZETCQYMHSA-N |
| XLogP | -0.43 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|