C8H13NO6 — CID 171060630
(2S)-2-(prop-2-enoylamino)pentanedioic acid;hydrate (PubChem CID 171060630) has the molecular formula C8H13NO6 and a molecular weight of 219.19 g/mol. Its IUPAC name is (2S)-2-(prop-2-enoylamino)pentanedioic acid;hydrate.
| Compound Name | (2S)-2-(prop-2-enoylamino)pentanedioic acid;hydrate |
|---|---|
| PubChem CID | 171060630 |
| Molecular Formula | C8H13NO6 |
| Molecular Weight | 219.19 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | (2S)-2-(prop-2-enoylamino)pentanedioic acid;hydrate |
| SMILES | C=CC(=O)N[C@@H](CCC(=O)O)C(=O)O.O |
| InChI | InChI=1S/C8H11NO5.H2O/c1-2-6(10)9-5(8(13)14)3-4-7(11)12;/h2,5H,1,3-4H2,(H,9,10)(H,11,12)(H,13,14);1H2/t5-;/m0./s1 |
| InChIKey | WNWIJQJMOKMNHP-JEDNCBNOSA-N |
| XLogP | -1.22 |
| TPSA | 135.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.19 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|