C8H13NO3S — CID 57369309
(2R)-3-prop-2-enylsulfanyl-2-[(2,2,2-trideuterioacetyl)amino]propanoic acid (PubChem CID 57369309) has the molecular formula C8H13NO3S and a molecular weight of 206.28 g/mol. Its IUPAC name is (2R)-3-prop-2-enylsulfanyl-2-[(2,2,2-trideuterioacetyl)amino]propanoic acid.
| Compound Name | (2R)-3-prop-2-enylsulfanyl-2-[(2,2,2-trideuterioacetyl)amino]propanoic acid |
|---|---|
| PubChem CID | 57369309 |
| Molecular Formula | C8H13NO3S |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | (2R)-3-prop-2-enylsulfanyl-2-[(2,2,2-trideuterioacetyl)amino]propanoic acid |
| SMILES | [2H]C([2H])([2H])C(=O)N[C@@H](CSCC=C)C(=O)O |
| InChI | InChI=1S/C8H13NO3S/c1-3-4-13-5-7(8(11)12)9-6(2)10/h3,7H,1,4-5H2,2H3,(H,9,10)(H,11,12)/t7-/m0/s1/i2D3 |
| InChIKey | LKRAEHUDIUJBSF-HMQROFFESA-N |
| XLogP | 0.49 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|