C22H40N2O4S — CID 139026060
N-cyclohexylcyclohexanamine;(2R)-3-[(E)-4-hydroxy-3-methylbut-2-enyl]sulfanyl-2-[(2,2,2-trideuterioacetyl)amino]propanoic acid (PubChem CID 139026060) has the molecular formula C22H40N2O4S and a molecular weight of 431.66 g/mol. Its IUPAC name is N-cyclohexylcyclohexanamine;(2R)-3-[(E)-4-hydroxy-3-methylbut-2-enyl]sulfanyl-2-[(2,2,2-trideuterioacetyl)amino]propanoic acid.
| Compound Name | N-cyclohexylcyclohexanamine;(2R)-3-[(E)-4-hydroxy-3-methylbut-2-enyl]sulfanyl-2-[(2,2,2-trideuterioacetyl)amino]propanoic acid |
|---|---|
| PubChem CID | 139026060 |
| Molecular Formula | C22H40N2O4S |
| Molecular Weight | 431.66 g/mol |
| Exact Mass | 431.29 |
| IUPAC Name | N-cyclohexylcyclohexanamine;(2R)-3-[(E)-4-hydroxy-3-methylbut-2-enyl]sulfanyl-2-[(2,2,2-trideuterioacetyl)amino]propanoic acid |
| SMILES | C1CCC(NC2CCCCC2)CC1.[2H]C([2H])([2H])C(=O)N[C@@H](CSC/C=C(\C)CO)C(=O)O |
| InChI | InChI=1S/C12H23N.C10H17NO4S/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-7(5-12)3-4-16-6-9(10(14)15)11-8(2)13/h11-13H,1-10H2;3,9,12H,4-6H2,1-2H3,(H,11,13)(H,14,15)/b;7-3+/t;9-/m.0/s1/i;2D3 |
| InChIKey | HIXZZZMHIYDVNS-XEAINBLXSA-N |
| XLogP | 3.49 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.66 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|