C21H40N2O4S — CID 139600524
2-acetamido-3-(4-hydroxybutan-2-ylsulfanyl)propanoic acid;N-cyclohexylcyclohexanamine (PubChem CID 139600524) has the molecular formula C21H40N2O4S and a molecular weight of 416.63 g/mol. Its IUPAC name is 2-acetamido-3-(4-hydroxybutan-2-ylsulfanyl)propanoic acid;N-cyclohexylcyclohexanamine.
| Compound Name | 2-acetamido-3-(4-hydroxybutan-2-ylsulfanyl)propanoic acid;N-cyclohexylcyclohexanamine |
|---|---|
| PubChem CID | 139600524 |
| Molecular Formula | C21H40N2O4S |
| Molecular Weight | 416.63 g/mol |
| Exact Mass | 416.27 |
| IUPAC Name | 2-acetamido-3-(4-hydroxybutan-2-ylsulfanyl)propanoic acid;N-cyclohexylcyclohexanamine |
| SMILES | C1CCC(NC2CCCCC2)CC1.CC(=O)NC(CSC(C)CCO)C(=O)O |
| InChI | InChI=1S/C12H23N.C9H17NO4S/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-6(3-4-11)15-5-8(9(13)14)10-7(2)12/h11-13H,1-10H2;6,8,11H,3-5H2,1-2H3,(H,10,12)(H,13,14) |
| InChIKey | FUBHBRRJHGBLML-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.63 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |