C9H17NO4S — CID 46780019
(2R)-2-acetamido-3-(4-hydroxybutan-2-ylsulfanyl)propanoic acid (PubChem CID 46780019) has the molecular formula C9H17NO4S and a molecular weight of 235.30 g/mol. Its IUPAC name is (2R)-2-acetamido-3-(4-hydroxybutan-2-ylsulfanyl)propanoic acid.
| Compound Name | (2R)-2-acetamido-3-(4-hydroxybutan-2-ylsulfanyl)propanoic acid |
|---|---|
| PubChem CID | 46780019 |
| Molecular Formula | C9H17NO4S |
| Molecular Weight | 235.30 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | (2R)-2-acetamido-3-(4-hydroxybutan-2-ylsulfanyl)propanoic acid |
| SMILES | CC(=O)N[C@@H](CSC(C)CCO)C(=O)O |
| InChI | InChI=1S/C9H17NO4S/c1-6(3-4-11)15-5-8(9(13)14)10-7(2)12/h6,8,11H,3-5H2,1-2H3,(H,10,12)(H,13,14)/t6?,8-/m0/s1 |
| InChIKey | NSRLJESZWULTTQ-XDKWHASVSA-N |
| XLogP | 0.08 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.30 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |