C6H11NO2S2 — CID 20657680
(2R)-3-prop-2-enylsulfanyl-2-(sulfanylamino)propanoic acid (PubChem CID 20657680) has the molecular formula C6H11NO2S2 and a molecular weight of 193.29 g/mol. Its IUPAC name is (2R)-3-prop-2-enylsulfanyl-2-(sulfanylamino)propanoic acid.
| Compound Name | (2R)-3-prop-2-enylsulfanyl-2-(sulfanylamino)propanoic acid |
|---|---|
| PubChem CID | 20657680 |
| Molecular Formula | C6H11NO2S2 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.02 |
| IUPAC Name | (2R)-3-prop-2-enylsulfanyl-2-(sulfanylamino)propanoic acid |
| SMILES | C=CCSC[C@H](NS)C(=O)O |
| InChI | InChI=1S/C6H11NO2S2/c1-2-3-11-4-5(7-10)6(8)9/h2,5,7,10H,1,3-4H2,(H,8,9)/t5-/m0/s1 |
| InChIKey | KUUQFNKNEJOHQX-YFKPBYRVSA-N |
| XLogP | 0.79 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|