C10H18N2O4S — CID 106430687
4-hydroxy-2-(2-prop-2-enylsulfanylethylcarbamoylamino)butanoic acid (PubChem CID 106430687) has the molecular formula C10H18N2O4S and a molecular weight of 262.33 g/mol. Its IUPAC name is 4-hydroxy-2-(2-prop-2-enylsulfanylethylcarbamoylamino)butanoic acid.
| Compound Name | 4-hydroxy-2-(2-prop-2-enylsulfanylethylcarbamoylamino)butanoic acid |
|---|---|
| PubChem CID | 106430687 |
| Molecular Formula | C10H18N2O4S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 4-hydroxy-2-(2-prop-2-enylsulfanylethylcarbamoylamino)butanoic acid |
| SMILES | C=CCSCCNC(=O)NC(CCO)C(=O)O |
| InChI | InChI=1S/C10H18N2O4S/c1-2-6-17-7-4-11-10(16)12-8(3-5-13)9(14)15/h2,8,13H,1,3-7H2,(H,14,15)(H2,11,12,16) |
| InChIKey | HUQXKQSCOCGVHG-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|