C12H16N2O3S2 — CID 106430661
2-(2-prop-2-enylsulfanylethylcarbamoylamino)-2-thiophen-2-ylacetic acid (PubChem CID 106430661) has the molecular formula C12H16N2O3S2 and a molecular weight of 300.41 g/mol. Its IUPAC name is 2-(2-prop-2-enylsulfanylethylcarbamoylamino)-2-thiophen-2-ylacetic acid.
| Compound Name | 2-(2-prop-2-enylsulfanylethylcarbamoylamino)-2-thiophen-2-ylacetic acid |
|---|---|
| PubChem CID | 106430661 |
| Molecular Formula | C12H16N2O3S2 |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 2-(2-prop-2-enylsulfanylethylcarbamoylamino)-2-thiophen-2-ylacetic acid |
| SMILES | C=CCSCCNC(=O)NC(C(=O)O)c1cccs1 |
| InChI | InChI=1S/C12H16N2O3S2/c1-2-6-18-8-5-13-12(17)14-10(11(15)16)9-4-3-7-19-9/h2-4,7,10H,1,5-6,8H2,(H,15,16)(H2,13,14,17) |
| InChIKey | YQQTZZLTOOIOBE-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|